|
CAS#: 85480-29-1 Product: Sodium hexyl hydrogen phosphate No suppilers available for the product. |
| Name | Sodium hexyl hydrogen phosphate |
|---|---|
| Synonyms | Phosphoric acid, hexyl ester, sodium salt |
| Molecular Structure | ![]() |
| Molecular Formula | C6H14NaO4P |
| Molecular Weight | 204.14 |
| CAS Registry Number | 85480-29-1 |
| EINECS | 287-308-0 |
| SMILES | [Na+].[O-]P(=O)(OCCCCCC)O |
| InChI | 1S/C6H15O4P.Na/c1-2-3-4-5-6-10-11(7,8)9;/h2-6H2,1H3,(H2,7,8,9);/q;+1/p-1 |
| InChIKey | QDZFJQPFGZWVHR-UHFFFAOYSA-M |
| Boiling point | 299.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 135°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium hexyl hydrogen phosphate |