|
CAS#: 85536-81-8 Product: Ethyl 3-hydroxy-3-(6-methoxy-2-naphthyl)-2,2-dimethylpentanoate No suppilers available for the product. |
| Name | Ethyl 3-hydroxy-3-(6-methoxy-2-naphthyl)-2,2-dimethylpentanoate |
|---|---|
| Synonyms | ethyl β-e |
| Molecular Structure | ![]() |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 |
| CAS Registry Number | 85536-81-8 |
| EINECS | 287-568-5 |
| SMILES | CCOC(=O)C(C)(C)C(O)(CC)c1ccc2cc(ccc2c1)OC |
| InChI | 1S/C20H26O4/c1-6-20(22,19(3,4)18(21)24-7-2)16-10-8-15-13-17(23-5)11-9-14(15)12-16/h8-13,22H,6-7H2,1-5H3 |
| InChIKey | BGPCDCAZLBBOTJ-UHFFFAOYSA-N |
| Density | 1.11g/cm3 (Cal.) |
|---|---|
| Boiling point | 478.503°C at 760 mmHg (Cal.) |
| Flash point | 164.709°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 3-hydroxy-3-(6-methoxy-2-naphthyl)-2,2-dimethylpentanoate |