|
CAS#: 85607-53-0 Product: 2-(1H-Indol-3-yl)-3-oxo-1-piperazinecarbaldehyde No suppilers available for the product. |
| Name | 2-(1H-Indol-3-yl)-3-oxo-1-piperazinecarbaldehyde |
|---|---|
| Synonyms | 1-Piperazinecarboxaldehyde, 2-(1H-indol-3-yl)-3-oxo-; 2-(1H-Indol-3-yl)-3-oxo-1-piperazinecarboxaldehyde |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.26 |
| CAS Registry Number | 85607-53-0 |
| SMILES | O=C3NCCN(C=O)C3c2c1ccccc1nc2 |
| InChI | 1S/C13H13N3O2/c17-8-16-6-5-14-13(18)12(16)10-7-15-11-4-2-1-3-9(10)11/h1-4,7-8,12,15H,5-6H2,(H,14,18) |
| InChIKey | GYGWAOJAJVHFKT-UHFFFAOYSA-N |
| Density | 1.404g/cm3 (Cal.) |
|---|---|
| Boiling point | 639.06°C at 760 mmHg (Cal.) |
| Flash point | 340.291°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(1H-Indol-3-yl)-3-oxo-1-piperazinecarbaldehyde |