|
CAS#: 85611-43-4 Product: 12,19-Dihydroxysenecionan-11,16-dione No suppilers available for the product. |
| Name | 12,19-Dihydroxysenecionan-11,16-dione |
|---|---|
| Synonyms | 19-Hydroxysenecionine; Senecionan-11,16-dione, 12,19-dihydroxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.39 |
| CAS Registry Number | 85611-43-4 |
| SMILES | O=C/1OC3CCN2C/C=C(/COC(=O)C(O)(C)C(CO)CC\1=C/C)C23 |
| InChI | 1S/C18H25NO6/c1-3-11-8-13(9-20)18(2,23)17(22)24-10-12-4-6-19-7-5-14(15(12)19)25-16(11)21/h3-4,13-15,20,23H,5-10H2,1-2H3 |
| InChIKey | XVKRSUITGOSAJK-UHFFFAOYSA-N |
| Density | 1.328g/cm3 (Cal.) |
|---|---|
| Boiling point | 609.97°C at 760 mmHg (Cal.) |
| Flash point | 322.698°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 12,19-Dihydroxysenecionan-11,16-dione |