|
CAS#: 85623-00-3 Product: 3-(2-Chloroethyl)-N,N-dimethyl-4-oxo-3,4-dihydroimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide No suppilers available for the product. |
| Name | 3-(2-Chloroethyl)-N,N-dimethyl-4-oxo-3,4-dihydroimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
|---|---|
| Synonyms | 3-(2-Chlo |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11ClN6O2 |
| Molecular Weight | 270.68 |
| CAS Registry Number | 85623-00-3 |
| SMILES | CN(C)C(=O)C1=C2N=NN(C(=O)N2C=N1)CCCl |
| InChI | 1S/C9H11ClN6O2/c1-14(2)8(17)6-7-12-13-16(4-3-10)9(18)15(7)5-11-6/h5H,3-4H2,1-2H3 |
| InChIKey | OMUDWEBSOQBFST-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 492.3±51.0°C at 760 mmHg (Cal.) |
| Flash point | 251.6±30.4°C (Cal.) |
| (1) | P. R. Lowe and C. H. Schwalbe. DCMCIT, an analogue of the antitumour drugs mitozolomide and temozolomide, Acta Cryst. (1994). C50, 1629-1631 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-(2-Chloroethyl)-N,N-dimethyl-4-oxo-3,4-dihydroimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |