|
CAS#: 85650-87-9 Product: 1,2-Dimethyl-3,4-bis(2-methyl-2-propanyl)naphthalene No suppilers available for the product. |
| Name | 1,2-Dimethyl-3,4-bis(2-methyl-2-propanyl)naphthalene |
|---|---|
| Synonyms | bis(1,1-dimethylethyl)dimethylnaphthalene |
| Molecular Structure | ![]() |
| Molecular Formula | C20H28 |
| Molecular Weight | 268.44 |
| CAS Registry Number | 85650-87-9 |
| EINECS | 288-097-8 |
| SMILES | c12ccccc1c(c(c(c2C(C)(C)C)C(C)(C)C)C)C |
| InChI | 1S/C20H28/c1-13-14(2)17(19(3,4)5)18(20(6,7)8)16-12-10-9-11-15(13)16/h9-12H,1-8H3 |
| InChIKey | OMLQMAOLMRPWAN-UHFFFAOYSA-N |
| Density | 0.927g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.193°C at 760 mmHg (Cal.) |
| Flash point | 185.421°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dimethyl-3,4-bis(2-methyl-2-propanyl)naphthalene |