|
CAS#: 85665-82-3 Product: 3-(4-Isopropylphenyl)-2-methyl-1-(2-phenylethoxy)-1-propanol No suppilers available for the product. |
| Name | 3-(4-Isopropylphenyl)-2-methyl-1-(2-phenylethoxy)-1-propanol |
|---|---|
| Synonyms | 3-(p-isopropylphenyl)-2-methyl-1-(phenethyloxy)propanol |
| Molecular Structure | ![]() |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 |
| CAS Registry Number | 85665-82-3 |
| EINECS | 288-174-6 |
| SMILES | OC(OCCc1ccccc1)C(Cc2ccc(cc2)C(C)C)C |
| InChI | 1S/C21H28O2/c1-16(2)20-11-9-19(10-12-20)15-17(3)21(22)23-14-13-18-7-5-4-6-8-18/h4-12,16-17,21-22H,13-15H2,1-3H3 |
| InChIKey | UFSYSTJMMODDEE-UHFFFAOYSA-N |
| Density | 1.029g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.661°C at 760 mmHg (Cal.) |
| Flash point | 160.739°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Isopropylphenyl)-2-methyl-1-(2-phenylethoxy)-1-propanol |