|
CAS#: 85702-62-1 Product: (17beta)-3-Oxoestr-4-en-17-yl 10-undecenoate No suppilers available for the product. |
| Name | (17beta)-3-Oxoestr-4-en-17-yl 10-undecenoate |
|---|---|
| Synonyms | 17-β-hydroxyestr-4-en-3-one 17-(undec-10-enoate) |
| Molecular Structure | ![]() |
| Molecular Formula | C29H44O3 |
| Molecular Weight | 440.66 |
| CAS Registry Number | 85702-62-1 |
| EINECS | 288-254-0 |
| SMILES | O=C4\C=C2/[C@@H]([C@H]1CC[C@@]3([C@@H](OC(=O)CCCCCCCC\C=C)CC[C@H]3[C@@H]1CC2)C)CC4 |
| InChI | 1S/C29H44O3/c1-3-4-5-6-7-8-9-10-11-28(31)32-27-17-16-26-25-14-12-21-20-22(30)13-15-23(21)24(25)18-19-29(26,27)2/h3,20,23-27H,1,4-19H2,2H3/t23-,24+,25+,26-,27-,29-/m0/s1 |
| InChIKey | FZHPIXXLEHKOKS-MVTMSODMSA-N |
| Density | 1.05g/cm3 (Cal.) |
|---|---|
| Boiling point | 550.351°C at 760 mmHg (Cal.) |
| Flash point | 231.81°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (17beta)-3-Oxoestr-4-en-17-yl 10-undecenoate |