|
CAS#: 85711-88-2 Product: 1,2-Dichloro-3-(2-chloro-2-phenylethyl)benzene No suppilers available for the product. |
| Name | 1,2-Dichloro-3-(2-chloro-2-phenylethyl)benzene |
|---|---|
| Synonyms | chloro[(dichlorophenyl)methyl]methylbenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11Cl3 |
| Molecular Weight | 285.60 |
| CAS Registry Number | 85711-88-2 |
| EINECS | 288-348-1 |
| SMILES | Clc1c(cccc1Cl)CC(Cl)c2ccccc2 |
| InChI | 1S/C14H11Cl3/c15-12-8-4-7-11(14(12)17)9-13(16)10-5-2-1-3-6-10/h1-8,13H,9H2 |
| InChIKey | YCYYKQAOEBEMPG-UHFFFAOYSA-N |
| Density | 1.304g/cm3 (Cal.) |
|---|---|
| Boiling point | 354.101°C at 760 mmHg (Cal.) |
| Flash point | 245.385°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dichloro-3-(2-chloro-2-phenylethyl)benzene |