|
CAS#: 85712-12-5 Product: Potassium 2-benzylphenolate No suppilers available for the product. |
| Name | Potassium 2-benzylphenolate |
|---|---|
| Synonyms | potassium o-benzylphenolate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H11KO |
| Molecular Weight | 222.32 |
| CAS Registry Number | 85712-12-5 |
| EINECS | 288-371-7 |
| SMILES | [K+].[O-]c1ccccc1Cc2ccccc2 |
| InChI | 1S/C13H12O.K/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11;/h1-9,14H,10H2;/q;+1/p-1 |
| InChIKey | HUDNINDREWCOFO-UHFFFAOYSA-M |
| Boiling point | 309.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 147.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Potassium 2-benzylphenolate |