|
CAS#: 85717-56-2 Product: (3aS,6aR)-3,3a,6,6a-Tetrahydro-1-pentalenecarboxylic acid No suppilers available for the product. |
| Name | (3aS,6aR)-3,3a,6,6a-Tetrahydro-1-pentalenecarboxylic acid |
|---|---|
| Synonyms | (3aS,6aR)-3,3a,6,6a-tetrahydropentalene-1-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.17 |
| CAS Registry Number | 85717-56-2 |
| SMILES | OC(=O)\C1=C\C[C@H]2/C=C\C[C@@H]12 |
| InChI | 1S/C9H10O2/c10-9(11)8-5-4-6-2-1-3-7(6)8/h1-2,5-7H,3-4H2,(H,10,11)/t6-,7-/m1/s1 |
| InChIKey | JZMUDRXVJAZFMZ-RNFRBKRXSA-N |
| Density | 1.254g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.285°C at 760 mmHg (Cal.) |
| Flash point | 140.71°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3aS,6aR)-3,3a,6,6a-Tetrahydro-1-pentalenecarboxylic acid |