|
CAS#: 85720-47-4 Product: 4,4'-(3,4-Hexanediyl)di(1,3-benzenediol) No suppilers available for the product. |
| Name | 4,4'-(3,4-Hexanediyl)di(1,3-benzenediol) |
|---|---|
| Synonyms | 1,3-benzenediol, 4,4'-(1,2-diethyl-1,2-ethanediyl)bis-; 4,4'-(1,2-Diethylethylene)diresorcinol |
| Molecular Structure | ![]() |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.36 |
| CAS Registry Number | 85720-47-4 |
| SMILES | CCC(C1=C(C=C(C=C1)O)O)C(CC)C2=C(C=C(C=C2)O)O |
| InChI | 1S/C18H22O4/c1-3-13(15-7-5-11(19)9-17(15)21)14(4-2)16-8-6-12(20)10-18(16)22/h5-10,13-14,19-22H,3-4H2,1-2H3 |
| InChIKey | ZTEGQXPXBLYCGL-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 501.0±30.0°C at 760 mmHg (Cal.) |
| Flash point | 234.4±19.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-(3,4-Hexanediyl)di(1,3-benzenediol) |