|
CAS#: 85720-82-7 Product: 1-Bromo-2-(1,2-dichloro-1,2,2-trifluoroethoxy)-1,1,2,2-tetrafluoroethane No suppilers available for the product. |
| Name | 1-Bromo-2-(1,2-dichloro-1,2,2-trifluoroethoxy)-1,1,2,2-tetrafluoroethane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C4BrCl2F7O |
| Molecular Weight | 347.84 |
| CAS Registry Number | 85720-82-7 |
| EINECS | 288-389-5 |
| SMILES | FC(F)(OC(Cl)(F)C(F)(Cl)F)C(Br)(F)F |
| InChI | 1S/C4BrCl2F7O/c5-1(8,9)4(13,14)15-3(7,12)2(6,10)11 |
| InChIKey | NGNRMWPNTBTVNN-UHFFFAOYSA-N |
| Density | 1.985g/cm3 (Cal.) |
|---|---|
| Boiling point | 161.913°C at 760 mmHg (Cal.) |
| Flash point | 51.723°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Bromo-2-(1,2-dichloro-1,2,2-trifluoroethoxy)-1,1,2,2-tetrafluoroethane |