|
CAS#: 85750-13-6 Product: 4-[(2-Chloro-4-nitrophenyl)diazenyl]-N-ethyl-N-[2-(1-isobutoxyethoxy)ethyl]aniline No suppilers available for the product. |
| Name | 4-[(2-Chloro-4-nitrophenyl)diazenyl]-N-ethyl-N-[2-(1-isobutoxyethoxy)ethyl]aniline |
|---|---|
| Synonyms | 4-[(2-chl |
| Molecular Structure | ![]() |
| Molecular Formula | C22H29ClN4O4 |
| Molecular Weight | 448.94 |
| CAS Registry Number | 85750-13-6 |
| EINECS | 288-538-4 |
| SMILES | Clc2cc(ccc2N=Nc1ccc(cc1)N(CC)CCOC(C)OCC(C)C)[N+]([O-])=O |
| InChI | 1S/C22H29ClN4O4/c1-5-26(12-13-30-17(4)31-15-16(2)3)19-8-6-18(7-9-19)24-25-22-11-10-20(27(28)29)14-21(22)23/h6-11,14,16-17H,5,12-13,15H2,1-4H3 |
| InChIKey | VWRRSPVNTFSBNV-UHFFFAOYSA-N |
| Density | 1.201g/cm3 (Cal.) |
|---|---|
| Boiling point | 567.49°C at 760 mmHg (Cal.) |
| Flash point | 297.008°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(2-Chloro-4-nitrophenyl)diazenyl]-N-ethyl-N-[2-(1-isobutoxyethoxy)ethyl]aniline |