|
CAS#: 85819-51-8 Product: (2E)-3-{4-Hydroxy-3-[(2Z)-4-hydroxy-3-methyl-2-buten-1-yl]-5-(3-methyl-2-buten-1-yl)phenyl}acrylic acid No suppilers available for the product. |
| Name | (2E)-3-{4-Hydroxy-3-[(2Z)-4-hydroxy-3-methyl-2-buten-1-yl]-5-(3-methyl-2-buten-1-yl)phenyl}acrylic acid |
|---|---|
| Synonyms | 2-Propeno |
| Molecular Structure | ![]() |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.39 |
| CAS Registry Number | 85819-51-8 |
| SMILES | O=C(O)\C=C\c1cc(c(O)c(c1)C/C=C(/C)CO)C\C=C(/C)C |
| InChI | 1S/C19H24O4/c1-13(2)4-7-16-10-15(6-9-18(21)22)11-17(19(16)23)8-5-14(3)12-20/h4-6,9-11,20,23H,7-8,12H2,1-3H3,(H,21,22)/b9-6+,14-5- |
| InChIKey | HEFPIIHDRLNTDN-ZCVOOGJLSA-N |
| Density | 1.161g/cm3 (Cal.) |
|---|---|
| Boiling point | 511.058°C at 760 mmHg (Cal.) |
| Flash point | 276.966°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2E)-3-{4-Hydroxy-3-[(2Z)-4-hydroxy-3-methyl-2-buten-1-yl]-5-(3-methyl-2-buten-1-yl)phenyl}acrylic acid |