Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Chloro-6,7,8,9-tetrahydrobenzo[g]cinnolin-4-ol |
|---|---|
| Synonyms | 3-chloro-6,7,8,9-tetrahydrobenzo[g]cinnolin-4-ol |
| Molecular Structure | ![CAS#: 858507-58-1, 3-Chloro-6,7,8,9-tetrahydrobenzo[g]cinnolin-4-ol](/moreStructures/858507-58-1.gif) |
| Molecular Formula | C12H11ClN2O |
| Molecular Weight | 234.68 |
| CAS Registry Number | 858507-58-1 |
| SMILES | c1c2c(cc3c1c(c(nn3)Cl)O)CCCC2 |
| InChI | 1S/C12H11ClN2O/c13-12-11(16)9-5-7-3-1-2-4-8(7)6-10(9)14-15-12/h5-6H,1-4H2,(H,14,16) |
| InChIKey | YMJZYWNMDXTIJZ-UHFFFAOYSA-N |
| Density | 1.404g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.497°C at 760 mmHg (Cal.) |
| Flash point | 141.584°C (Cal.) |
| Refractive index | 1.689 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-6,7,8,9-tetrahydrobenzo[g]cinnolin-4-ol |