|
CAS#: 85896-07-7 Product: 5-Chloro-2-methoxy-N-(2-pyridinyl)-1,4-benzenediamine No suppilers available for the product. |
| Name | 5-Chloro-2-methoxy-N-(2-pyridinyl)-1,4-benzenediamine |
|---|---|
| Synonyms | 2-chloro-5-methoxy-4-(2-pyridylamino)aniline |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12ClN3O |
| Molecular Weight | 249.70 |
| CAS Registry Number | 85896-07-7 |
| EINECS | 288-784-2 |
| SMILES | Clc1cc(c(OC)cc1N)Nc2ncccc2 |
| InChI | 1S/C12H12ClN3O/c1-17-11-7-9(14)8(13)6-10(11)16-12-4-2-3-5-15-12/h2-7H,14H2,1H3,(H,15,16) |
| InChIKey | YTXHHNWAQVDITA-UHFFFAOYSA-N |
| Density | 1.336g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.02°C at 760 mmHg (Cal.) |
| Flash point | 185.444°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-2-methoxy-N-(2-pyridinyl)-1,4-benzenediamine |