|
CAS#: 862201-34-1 Product: N,N-Dimethyl-4-(5-phenyl-1H-pyrrol-3-yl)aniline No suppilers available for the product. |
| Name | N,N-Dimethyl-4-(5-phenyl-1H-pyrrol-3-yl)aniline |
|---|---|
| Synonyms | 2-PHENYL-4-(P-DIMETHYLAMINOPHENYL)-PYRROLE; Dimethyl-[4-(5-phenyl-1H-pyrrol-3-yl)-phenyl]-amine |
| Molecular Structure | ![]() |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.35 |
| CAS Registry Number | 862201-34-1 |
| SMILES | c3(ccc(c2cc(c1ccccc1)nc2)cc3)N(C)C |
| InChI | 1S/C18H18N2/c1-20(2)17-10-8-14(9-11-17)16-12-18(19-13-16)15-6-4-3-5-7-15/h3-13,19H,1-2H3 |
| InChIKey | FFGSWMJHQVLZNW-UHFFFAOYSA-N |
| Density | 1.11g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.344°C at 760 mmHg (Cal.) |
| Flash point | 236.442°C (Cal.) |
| Refractive index | 1.63 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-4-(5-phenyl-1H-pyrrol-3-yl)aniline |