|
CAS#: 862205-35-4 Product: 2-Methyl-2-propanyl [2-(aminomethyl)-4-methylbenzyl]carbamate No suppilers available for the product. |
| Name | 2-Methyl-2-propanyl [2-(aminomethyl)-4-methylbenzyl]carbamate |
|---|---|
| Synonyms | [2-(Amino |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 |
| CAS Registry Number | 862205-35-4 |
| SMILES | Cc1ccc(c(c1)CN)CNC(=O)OC(C)(C)C |
| InChI | 1S/C14H22N2O2/c1-10-5-6-11(12(7-10)8-15)9-16-13(17)18-14(2,3)4/h5-7H,8-9,15H2,1-4H3,(H,16,17) |
| InChIKey | INZVSBLPAGWEDC-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 392.0±30.0°C at 760 mmHg (Cal.) |
| Flash point | 190.9±24.6°C (Cal.) |
| Refractive index | 1.528 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl [2-(aminomethyl)-4-methylbenzyl]carbamate |