|
CAS#: 86229-44-9 Product: 4-Acetamidophenyl acrylate No suppilers available for the product. |
| Name | 4-Acetamidophenyl acrylate |
|---|---|
| Synonyms | 2-Propenoic acid 4-(acetylamino)phenyl ester; 4-acryloyloxyacetanilide |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 |
| CAS Registry Number | 86229-44-9 |
| SMILES | O=C(Oc1ccc(cc1)NC(=O)C)\C=C |
| InChI | 1S/C11H11NO3/c1-3-11(14)15-10-6-4-9(5-7-10)12-8(2)13/h3-7H,1H2,2H3,(H,12,13) |
| InChIKey | XYNAFWYTBGZRSC-UHFFFAOYSA-N |
| Density | 1.195g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.366°C at 760 mmHg (Cal.) |
| Flash point | 202.587°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Acetamidophenyl acrylate |