|
CAS#: 86257-07-0 Product: 7-(3,4-Dihydroxybutyl)-1,3-dipropyl-3,7-dihydro-1H-purine-2,6-dione No suppilers available for the product. |
| Name | 7-(3,4-Dihydroxybutyl)-1,3-dipropyl-3,7-dihydro-1H-purine-2,6-dione |
|---|---|
| Synonyms | 1H-Purine |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24N4O4 |
| Molecular Weight | 324.38 |
| CAS Registry Number | 86257-07-0 |
| SMILES | O=C2N(c1ncn(c1C(=O)N2CCC)CCC(O)CO)CCC |
| InChI | 1S/C15H24N4O4/c1-3-6-18-13-12(14(22)19(7-4-2)15(18)23)17(10-16-13)8-5-11(21)9-20/h10-11,20-21H,3-9H2,1-2H3 |
| InChIKey | NCYWPNMRZIIZBZ-UHFFFAOYSA-N |
| Density | 1.343g/cm3 (Cal.) |
|---|---|
| Boiling point | 593.877°C at 760 mmHg (Cal.) |
| Flash point | 312.966°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-(3,4-Dihydroxybutyl)-1,3-dipropyl-3,7-dihydro-1H-purine-2,6-dione |