Online Database of Chemicals from Around the World
|
CAS#: 86333-80-4 Product: (7S,9S)-9-Glycoloyl-6,7,9,11-tetrahydroxy-7,8,9,10-tetrahydro-5,12-tetracenedione No suppilers available for the product. |
| Name | (7S,9S)-9-Glycoloyl-6,7,9,11-tetrahydroxy-7,8,9,10-tetrahydro-5,12-tetracenedione |
|---|---|
| Synonyms | 4-Demethoxyadriamycinone; 4-Demethoxydoxorubicinone |
| Molecular Structure |  |
| Molecular Formula | C20H16O8 |
| Molecular Weight | 384.34 |
| CAS Registry Number | 86333-80-4 |
| SMILES | O=C2c3c(C(=O)c1ccccc12)c(O)c4c(c3O)[C@@H](O)C[C@](O)(C(=O)CO)C4 |
| InChI | 1S/C20H16O8/c21-7-12(23)20(28)5-10-13(11(22)6-20)19(27)15-14(18(10)26)16(24)8-3-1-2-4-9(8)17(15)25/h1-4,11,21-22,26-28H,5-7H2/t11-,20-/m0/s1 |
| InChIKey | MWROBUNHUAIFQH-YBTHPKLGSA-N |
| Density | 1.716g/cm3 (Cal.) |
|---|---|
| Boiling point | 676.077°C at 760 mmHg (Cal.) |
| Flash point | 376.656°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (7S,9S)-9-Glycoloyl-6,7,9,11-tetrahydroxy-7,8,9,10-tetrahydro-5,12-tetracenedione |