|
CAS#: 86398-85-8 Product: 1-[3-Ethoxy-2-(4-morpholinyl)propyl]-3-phenylurea No suppilers available for the product. |
| Name | 1-[3-Ethoxy-2-(4-morpholinyl)propyl]-3-phenylurea |
|---|---|
| Synonyms | N-(3-Ethoxy-2-(4-morpholinyl)propyl)-N'-phenylurea; Urea, N-(3-ethoxy-2-(4-morpholinyl)propyl)-N'-phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 |
| CAS Registry Number | 86398-85-8 |
| SMILES | O=C(Nc1ccccc1)NCC(N2CCOCC2)COCC |
| InChI | 1S/C16H25N3O3/c1-2-21-13-15(19-8-10-22-11-9-19)12-17-16(20)18-14-6-4-3-5-7-14/h3-7,15H,2,8-13H2,1H3,(H2,17,18,20) |
| InChIKey | IXCULUSBOMOMHC-UHFFFAOYSA-N |
| Density | 1.154g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.248°C at 760 mmHg (Cal.) |
| Flash point | 220.659°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[3-Ethoxy-2-(4-morpholinyl)propyl]-3-phenylurea |