|
CAS#: 86451-86-7 Product: N-(Diphosphonomethyl)-N-methylglycine No suppilers available for the product. |
| Name | N-(Diphosphonomethyl)-N-methylglycine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C4H11NO8P2 |
| Molecular Weight | 263.08 |
| CAS Registry Number | 86451-86-7 |
| EINECS | 289-238-6 |
| SMILES | O=P(O)(O)C(N(C)CC(=O)O)P(=O)(O)O |
| InChI | 1S/C4H11NO8P2/c1-5(2-3(6)7)4(14(8,9)10)15(11,12)13/h4H,2H2,1H3,(H,6,7)(H2,8,9,10)(H2,11,12,13) |
| InChIKey | HXUQIWPUXBVDGE-UHFFFAOYSA-N |
| Density | 1.947g/cm3 (Cal.) |
|---|---|
| Boiling point | 639.834°C at 760 mmHg (Cal.) |
| Flash point | 340.759°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(Diphosphonomethyl)-N-methylglycine |