|
CAS#: 864754-04-1 Product: N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-S-(2-thienylmethyl)cysteine No suppilers available for the product. |
| Name | N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-S-(2-thienylmethyl)cysteine |
|---|---|
| Synonyms | Cysteine, |
| Molecular Structure | ![]() |
| Molecular Formula | C23H21NO4S2 |
| Molecular Weight | 439.55 |
| CAS Registry Number | 864754-04-1 |
| SMILES | c1ccc2c(c1)-c3ccccc3C2COC(=O)NC(CSCc4cccs4)C(=O)O |
| InChI | 1S/C23H21NO4S2/c25-22(26)21(14-29-13-15-6-5-11-30-15)24-23(27)28-12-20-18-9-3-1-7-16(18)17-8-2-4-10-19(17)20/h1-11,20-21H,12-14H2,(H,24,27)(H,25,26) |
| InChIKey | JNQBBCYRJYNXNQ-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 666.2±55.0°C at 760 mmHg (Cal.) |
| Flash point | 356.7±31.5°C (Cal.) |
| Refractive index | 1.66 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-S-(2-thienylmethyl)cysteine |