|
CAS#: 864754-47-2 Product: 2-[4-(2-Fluoro-Ethoxy)-Phenyl]-4,4,5,5-Tetramethyl-[1,3,2]Dioxaborolane No suppilers available for the product. |
| Name | 2-[4-(2-Fluoro-Ethoxy)-Phenyl]-4,4,5,5-Tetramethyl-[1,3,2]Dioxaborolane |
|---|---|
| Synonyms | Fs010882 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20BFO3 |
| Molecular Weight | 266.12 |
| CAS Registry Number | 864754-47-2 |
| SMILES | C1=C(C=CC(=C1)OCCF)B2OC(C(O2)(C)C)(C)C |
| InChI | 1S/C14H20BFO3/c1-13(2)14(3,4)19-15(18-13)11-5-7-12(8-6-11)17-10-9-16/h5-8H,9-10H2,1-4H3 |
| InChIKey | RJQFPXYMWQGKNI-UHFFFAOYSA-N |
| Density | 1.07g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.308°C at 760 mmHg (Cal.) |
| Flash point | 166.87°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-[4-(2-Fluoro-Ethoxy)-Phenyl]-4,4,5,5-Tetramethyl-[1,3,2]Dioxaborolane |