|
CAS#: 866030-59-3 Product: Methyl 1-(4-bromophenyl)-2-aziridinecarboxylate No suppilers available for the product. |
| Name | Methyl 1-(4-bromophenyl)-2-aziridinecarboxylate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H10BrNO2 |
| Molecular Weight | 256.10 |
| CAS Registry Number | 866030-59-3 |
| SMILES | Brc1ccc(cc1)N2C(C(=O)OC)C2 |
| InChI | 1S/C10H10BrNO2/c1-14-10(13)9-6-12(9)8-4-2-7(11)3-5-8/h2-5,9H,6H2,1H3 |
| InChIKey | FOQIYFZPXZFOBS-UHFFFAOYSA-N |
| Density | 1.578g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.908°C at 760 mmHg (Cal.) |
| Flash point | 155.742°C (Cal.) |
| Refractive index | 1.605 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 1-(4-bromophenyl)-2-aziridinecarboxylate |