|
CAS#: 86626-72-4 Product: 2-[Ethyl(4-formyl-3-methylphenyl)amino]ethyl 3-(trichloromethyl)benzoate No suppilers available for the product. |
| Name | 2-[Ethyl(4-formyl-3-methylphenyl)amino]ethyl 3-(trichloromethyl)benzoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H20Cl3NO3 |
| Molecular Weight | 428.74 |
| CAS Registry Number | 86626-72-4 |
| EINECS | 289-262-7 |
| SMILES | ClC(Cl)(Cl)c1cccc(c1)C(=O)OCCN(c2cc(c(cc2)C=O)C)CC |
| InChI | 1S/C20H20Cl3NO3/c1-3-24(18-8-7-16(13-25)14(2)11-18)9-10-27-19(26)15-5-4-6-17(12-15)20(21,22)23/h4-8,11-13H,3,9-10H2,1-2H3 |
| InChIKey | CFBXNTURAPEGTI-UHFFFAOYSA-N |
| Density | 1.332g/cm3 (Cal.) |
|---|---|
| Boiling point | 568.248°C at 760 mmHg (Cal.) |
| Flash point | 297.466°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[Ethyl(4-formyl-3-methylphenyl)amino]ethyl 3-(trichloromethyl)benzoate |