|
CAS#: 86630-17-3 Product: 1-{(1R)-1-Carboxy-4-[(diaminomethylene)amino]butyl}-5-oxo-L-proline No suppilers available for the product. |
| Name | 1-{(1R)-1-Carboxy-4-[(diaminomethylene)amino]butyl}-5-oxo-L-proline |
|---|---|
| Synonyms | 1-Pyrroli |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18N4O5 |
| Molecular Weight | 286.28 |
| CAS Registry Number | 86630-17-3 |
| SMILES | O=C(O)[C@H](N1C(=O)CC[C@H]1C(=O)O)CCC/N=C(\N)N |
| InChI | 1S/C11H18N4O5/c12-11(13)14-5-1-2-6(9(17)18)15-7(10(19)20)3-4-8(15)16/h6-7H,1-5H2,(H,17,18)(H,19,20)(H4,12,13,14)/t6-,7+/m1/s1 |
| InChIKey | GTRMYGUJZGMZEF-RQJHMYQMSA-N |
| Density | 1.62g/cm3 (Cal.) |
|---|---|
| Boiling point | 669.031°C at 760 mmHg (Cal.) |
| Flash point | 358.417°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-{(1R)-1-Carboxy-4-[(diaminomethylene)amino]butyl}-5-oxo-L-proline |