|
CAS#: 866362-07-4 Product: Dibenzo[b,d]furan-1,2,8,9-tetramine No suppilers available for the product. |
| Name | Dibenzo[b,d]furan-1,2,8,9-tetramine |
|---|---|
| Synonyms | 1,2,8,9-Dibenzofurantetramine; Dibenzo[b,d]furan-1,2,8,9-tetramin |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 |
| CAS Registry Number | 866362-07-4 |
| SMILES | c1cc2c(c3c(o2)ccc(c3N)N)c(c1N)N |
| InChI | 1S/C12H12N4O/c13-5-1-3-7-9(11(5)15)10-8(17-7)4-2-6(14)12(10)16/h1-4H,13-16H2 |
| InChIKey | YXNDELWRBAWSMS-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 568.3±45.0°C at 760 mmHg (Cal.) |
| Flash point | 297.5±28.7°C (Cal.) |
| Refractive index | 1.93 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dibenzo[b,d]furan-1,2,8,9-tetramine |