| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Tyger Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (609) 434-0144 | |||
![]() |
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Name | Methyl 7-(3-buten-2-yl)-6-hydroxy-5-oxo-1,2,3,5-tetrahydro-8-indolizinecarboxylate |
|---|---|
| Synonyms | 8-INDOLIZ |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 |
| CAS Registry Number | 866393-52-4 |
| SMILES | O=C1C(\O)=C(/C(=C2\N1CCC2)C(=O)OC)C(\C=C)C |
| InChI | 1S/C14H17NO4/c1-4-8(2)10-11(14(18)19-3)9-6-5-7-15(9)13(17)12(10)16/h4,8,16H,1,5-7H2,2-3H3 |
| InChIKey | STGDYOYYKACPQU-UHFFFAOYSA-N |
| Density | 1.264g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.328°C at 760 mmHg (Cal.) |
| Flash point | 220.708°C (Cal.) |
| Refractive index | 1.575 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 7-(3-buten-2-yl)-6-hydroxy-5-oxo-1,2,3,5-tetrahydro-8-indolizinecarboxylate |