| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Tyger Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (609) 434-0144 | |||
![]() |
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Name | Methyl 2-methyl-9-oxo-5,6,7,9-tetrahydrofuro[2,3-f]indolizine-4-carboxylate |
|---|---|
| Synonyms | methyl 2- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 |
| CAS Registry Number | 866393-55-7 |
| SMILES | O=C(OC)C=2c1c(oc(c1)C)C(=O)N3C=2CCC3 |
| InChI | 1S/C13H13NO4/c1-7-6-8-10(13(16)17-2)9-4-3-5-14(9)12(15)11(8)18-7/h6H,3-5H2,1-2H3 |
| InChIKey | HDYOSEOUPGWXAC-UHFFFAOYSA-N |
| Density | 1.362g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.557°C at 760 mmHg (Cal.) |
| Flash point | 216.612°C (Cal.) |
| Refractive index | 1.6 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-methyl-9-oxo-5,6,7,9-tetrahydrofuro[2,3-f]indolizine-4-carboxylate |