|
CAS#: 866475-34-5 Product: 4-{(E)-2-[4-(Methylamino)phenyl]vinyl}phenol No suppilers available for the product. |
| Name | 4-{(E)-2-[4-(Methylamino)phenyl]vinyl}phenol |
|---|---|
| Synonyms | (E)-4-(4-(methylamino)styryl)phenol; 4-(4-(Methylamino)styryl)phenol; 4-[(E)-2-(4-Methylamino-phenyl)-vinyl]-phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 |
| CAS Registry Number | 866475-34-5 |
| SMILES | CNC1=CC=C(C=C1)/C=C/C2=CC=C(C=C2)O |
| InChI | 1S/C15H15NO/c1-16-14-8-4-12(5-9-14)2-3-13-6-10-15(17)11-7-13/h2-11,16-17H,1H3/b3-2+ |
| InChIKey | ZWIARAQZLULYPG-NSCUHMNNSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.4±24.0°C at 760 mmHg (Cal.) |
| Flash point | 157.9±13.5°C (Cal.) |
| Refractive index | 1.719 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-{(E)-2-[4-(Methylamino)phenyl]vinyl}phenol |