Online Database of Chemicals from Around the World
|
CAS#: 86714-34-3 Product: 1,1,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-Hexadecafluoro-2-(trifluoromethyl)decahydroisoquinoline No suppilers available for the product. |
| Name | 1,1,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-Hexadecafluoro-2-(trifluoromethyl)decahydroisoquinoline |
|---|---|
| Synonyms | 1,1,3,3,4 |
| Molecular Structure |  |
| Molecular Formula | C10F19N |
| Molecular Weight | 495.08 |
| CAS Registry Number | 86714-34-3 |
| SMILES | FC(F)(F)N2C(F)(F)C(F)(F)C1(F)C(F)(C(F)(F)C(F)(F)C(F)(F)C1(F)F)C2(F)F |
| InChI | 1S/C10F19N/c11-1-2(12,4(15,16)7(21,22)6(19,20)3(1,13)14)8(23,24)30(10(27,28)29)9(25,26)5(1,17)18 |
| InChIKey | MRQNKLRMROXHTI-UHFFFAOYSA-N |
| Density | 1.882g/cm3 (Cal.) |
|---|---|
| Boiling point | 128.648°C at 760 mmHg (Cal.) |
| Flash point | 31.606°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-Hexadecafluoro-2-(trifluoromethyl)decahydroisoquinoline |