|
CAS#: 86806-69-1 Product: N-{2-[(2-Bromo-4,6-dinitrophenyl)diazenyl]-5-[ethyl(3-phenylpropyl)amino]phenyl}acetamide No suppilers available for the product. |
| Name | N-{2-[(2-Bromo-4,6-dinitrophenyl)diazenyl]-5-[ethyl(3-phenylpropyl)amino]phenyl}acetamide |
|---|---|
| Synonyms | N-[2-[(2- |
| Molecular Structure | ![]() |
| Molecular Formula | C25H25BrN6O5 |
| Molecular Weight | 569.41 |
| CAS Registry Number | 86806-69-1 |
| EINECS | 289-280-5 |
| SMILES | Brc3cc(cc(c3N=Nc1ccc(cc1NC(C)=O)N(CC)CCCc2ccccc2)[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C25H25BrN6O5/c1-3-30(13-7-10-18-8-5-4-6-9-18)19-11-12-22(23(15-19)27-17(2)33)28-29-25-21(26)14-20(31(34)35)16-24(25)32(36)37/h4-6,8-9,11-12,14-16H,3,7,10,13H2,1-2H3,(H,27,33) |
| InChIKey | QTOMAVNNZJSYOV-UHFFFAOYSA-N |
| Density | 1.45g/cm3 (Cal.) |
|---|---|
| Boiling point | 773.86°C at 760 mmHg (Cal.) |
| Flash point | 421.816°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-{2-[(2-Bromo-4,6-dinitrophenyl)diazenyl]-5-[ethyl(3-phenylpropyl)amino]phenyl}acetamide |