|
CAS#: 86819-22-9 Product: 4-{[1-{2-[2-(3-Chlorophenyl)ethyl]phenoxy}-3-(dimethylamino)-2-propanyl]oxy}-4-oxobutanoic acid hydrochloride (1:1) No suppilers available for the product. |
| Name | 4-{[1-{2-[2-(3-Chlorophenyl)ethyl]phenoxy}-3-(dimethylamino)-2-propanyl]oxy}-4-oxobutanoic acid hydrochloride (1:1) |
|---|---|
| Synonyms | Butanedio |
| Molecular Structure | ![]() |
| Molecular Formula | C23H29Cl2NO5 |
| Molecular Weight | 470.39 |
| CAS Registry Number | 86819-22-9 |
| SMILES | Clc1cc(ccc1)CCc2ccccc2OCC(OC(=O)CCC(=O)O)CN(C)C.Cl |
| InChI | 1S/C23H28ClNO5.ClH/c1-25(2)15-20(30-23(28)13-12-22(26)27)16-29-21-9-4-3-7-18(21)11-10-17-6-5-8-19(24)14-17;/h3-9,14,20H,10-13,15-16H2,1-2H3,(H,26,27);1H |
| InChIKey | GNWOHXUPPNIPBI-UHFFFAOYSA-N |
| Boiling point | 578°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 303.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-{[1-{2-[2-(3-Chlorophenyl)ethyl]phenoxy}-3-(dimethylamino)-2-propanyl]oxy}-4-oxobutanoic acid hydrochloride (1:1) |