|
CAS#: 86820-21-5 Product: 4-(2-Amino-1-hydroxyethyl)-5-fluoro-1,2-benzenediol No suppilers available for the product. |
| Name | 4-(2-Amino-1-hydroxyethyl)-5-fluoro-1,2-benzenediol |
|---|---|
| Synonyms | (±)4-(2-Amino-1-hydroxy-ethyl)-5-fluoro-benzene-1,2-diol; 4-(2-Amino-1-hydroxyethyl)-5-fluoro-1,2-benzenediol #; 4-(2-Amino-1-hydroxy-ethyl)-5-fluoro-benzene-1,2-diol |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10FNO3 |
| Molecular Weight | 187.17 |
| CAS Registry Number | 86820-21-5 |
| SMILES | C1=C(C(=CC(=C1O)O)F)C(CN)O |
| InChI | 1S/C8H10FNO3/c9-5-2-7(12)6(11)1-4(5)8(13)3-10/h1-2,8,11-13H,3,10H2 |
| InChIKey | SBUQBFTXTZSRMH-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 445.1±40.0°C at 760 mmHg (Cal.) |
| Flash point | 223.0±27.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2-Amino-1-hydroxyethyl)-5-fluoro-1,2-benzenediol |