|
CAS#: 86827-66-9 Product: 5-Methyl-1,2-chrysenedione No suppilers available for the product. |
| Name | 5-Methyl-1,2-chrysenedione |
|---|---|
| Synonyms | 5-Methyl-1,2-chrysenedione; CCRIS 7619 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H12O2 |
| Molecular Weight | 272.30 |
| CAS Registry Number | 86827-66-9 |
| SMILES | O=C3c4ccc2c1ccccc1cc(c2c4\C=C/C3=O)C |
| InChI | 1S/C19H12O2/c1-11-10-12-4-2-3-5-13(12)14-6-7-16-15(18(11)14)8-9-17(20)19(16)21/h2-10H,1H3 |
| InChIKey | XNSVJANXWKEDCJ-UHFFFAOYSA-N |
| Density | 1.315g/cm3 (Cal.) |
|---|---|
| Boiling point | 507.458°C at 760 mmHg (Cal.) |
| Flash point | 221.896°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-1,2-chrysenedione |