|
CAS#: 86871-75-2 Product: (2R,3R)-2,3-Dihydroxysuccinic acid - 3-{[5-(4-chlorophenyl)-4-methyl-1H-pyrazol-3-yl]oxy}-N,N-dimethyl-1-propanamine (1:1) No suppilers available for the product. |
| Name | (2R,3R)-2,3-Dihydroxysuccinic acid - 3-{[5-(4-chlorophenyl)-4-methyl-1H-pyrazol-3-yl]oxy}-N,N-dimethyl-1-propanamine (1:1) |
|---|---|
| Synonyms | 1-Propana |
| Molecular Structure | ![]() |
| Molecular Formula | C19H26ClN3O7 |
| Molecular Weight | 443.88 |
| CAS Registry Number | 86871-75-2 |
| SMILES | O=C(O)[C@H](O)[C@@H](O)C(=O)O.Clc2ccc(c1c(c(OCCCN(C)C)nn1)C)cc2 |
| InChI | 1S/C15H20ClN3O.C4H6O6/c1-11-14(12-5-7-13(16)8-6-12)17-18-15(11)20-10-4-9-19(2)3;5-1(3(7)8)2(6)4(9)10/h5-8H,4,9-10H2,1-3H3,(H,17,18);1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1 |
| InChIKey | GMZAMGOYHWEPCC-LREBCSMRSA-N |
| Boiling point | 443.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 222.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R,3R)-2,3-Dihydroxysuccinic acid - 3-{[5-(4-chlorophenyl)-4-methyl-1H-pyrazol-3-yl]oxy}-N,N-dimethyl-1-propanamine (1:1) |