|
CAS#: 869-17-0 Product: Trifluoromethylglyoxal-Bis(Guanylhydrazone) No suppilers available for the product. |
| Name | Trifluoromethylglyoxal-Bis(Guanylhydrazone) |
|---|---|
| Synonyms | Hydrazinecarboximidamide, 2,2'-(1-(Trifluoromethyl)-1,2-Ethanediylidene)Bis-; Trifluoromethylglyoxal-Bis(Guanylhydrazone) |
| Molecular Structure | ![]() |
| Molecular Formula | C5H9F3N8 |
| Molecular Weight | 238.17 |
| CAS Registry Number | 869-17-0 |
| SMILES | C(=N/N=C(N)N)(C(F)(F)F)\C=N\N=C(N)N |
| InChI | 1S/C5H9F3N8/c6-5(7,8)2(14-16-4(11)12)1-13-15-3(9)10/h1H,(H4,9,10,15)(H4,11,12,16)/b13-1+,14-2- |
| InChIKey | UIOTXAGUOYYBFH-OGYFSDGLSA-N |
| Density | 1.788g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.709°C at 760 mmHg (Cal.) |
| Flash point | 179.813°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trifluoromethylglyoxal-Bis(Guanylhydrazone) |