Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 2-Methoxyphenyl Salicylate |
|---|---|
| Synonyms | 2-Hydroxybenzoic Acid (2-Methoxyphenyl) Ester; Salicylic Acid, O-Methoxyphenyl Ester; Benzoic Acid, 2-Hydroxy-, 2-Methoxyphenyl Ester |
| Molecular Structure |  |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.25 |
| CAS Registry Number | 87-16-1 |
| EINECS | 201-726-2 |
| SMILES | C1=CC=CC(=C1C(OC2=C(OC)C=CC=C2)=O)O |
| InChI | 1S/C14H12O4/c1-17-12-8-4-5-9-13(12)18-14(16)10-6-2-3-7-11(10)15/h2-9,15H,1H3 |
| InChIKey | APMWEQQELZTXTL-UHFFFAOYSA-N |
| Density | 1.251g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.339°C at 760 mmHg (Cal.) |
| Flash point | 152.514°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methoxyphenyl Salicylate |