|
CAS#: 870007-42-4 Product: Methyl 4-(2-cyano-2-propanyl)-2-ethoxybenzoate No suppilers available for the product. |
| Name | Methyl 4-(2-cyano-2-propanyl)-2-ethoxybenzoate |
|---|---|
| Synonyms | 4-(Cyano-dimethyl-methyl)-2-ethoxy-benzoic acid methyl ester |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 |
| CAS Registry Number | 870007-42-4 |
| SMILES | CCOc1cc(ccc1C(=O)OC)C(C)(C)C#N |
| InChI | 1S/C14H17NO3/c1-5-18-12-8-10(14(2,3)9-15)6-7-11(12)13(16)17-4/h6-8H,5H2,1-4H3 |
| InChIKey | UCUDMRGGGWTXKK-UHFFFAOYSA-N |
| Density | 1.085g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.348°C at 760 mmHg (Cal.) |
| Flash point | 165.934°C (Cal.) |
| Refractive index | 1.505 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4-(2-cyano-2-propanyl)-2-ethoxybenzoate |