|
CAS#: 87018-26-6 Product: 8-Isopropyl-2,5-dimethyl-1,4-naphthoquinone No suppilers available for the product. |
| Name | 8-Isopropyl-2,5-dimethyl-1,4-naphthoquinone |
|---|---|
| Synonyms | Stahlianthusone |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 |
| CAS Registry Number | 87018-26-6 |
| SMILES | O=C\2c1c(ccc(c1C(=O)/C(=C/2)C)C(C)C)C |
| InChI | 1S/C15H16O2/c1-8(2)11-6-5-9(3)13-12(16)7-10(4)15(17)14(11)13/h5-8H,1-4H3 |
| InChIKey | ZPQRKKKZKXGBCB-UHFFFAOYSA-N |
| Density | 1.103g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.164°C at 760 mmHg (Cal.) |
| Flash point | 143.311°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Isopropyl-2,5-dimethyl-1,4-naphthoquinone |