|
CAS#: 87049-57-8 Product: 4-{[2-(2,4-Dichlorophenyl)-2-hydroxy-3-(1H-imidazol-1-yl)propyl]sulfanyl}butanoic acid No suppilers available for the product. |
| Name | 4-{[2-(2,4-Dichlorophenyl)-2-hydroxy-3-(1H-imidazol-1-yl)propyl]sulfanyl}butanoic acid |
|---|---|
| Synonyms | 4-((2-(2, |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18Cl2N2O3S |
| Molecular Weight | 389.30 |
| CAS Registry Number | 87049-57-8 |
| SMILES | Clc1ccc(c(Cl)c1)C(O)(CSCCCC(=O)O)Cn2ccnc2 |
| InChI | 1S/C16H18Cl2N2O3S/c17-12-3-4-13(14(18)8-12)16(23,9-20-6-5-19-11-20)10-24-7-1-2-15(21)22/h3-6,8,11,23H,1-2,7,9-10H2,(H,21,22) |
| InChIKey | DOHIVGMNASTKIY-UHFFFAOYSA-N |
| Density | 1.395g/cm3 (Cal.) |
|---|---|
| Boiling point | 668.236°C at 760 mmHg (Cal.) |
| Flash point | 357.936°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-{[2-(2,4-Dichlorophenyl)-2-hydroxy-3-(1H-imidazol-1-yl)propyl]sulfanyl}butanoic acid |