|
CAS#: 871101-30-3 Product: 6-Iodo-2-[4-(methylamino)phenyl]-4H-chromen-4-one No suppilers available for the product. |
| Name | 6-Iodo-2-[4-(methylamino)phenyl]-4H-chromen-4-one |
|---|---|
| Synonyms | 6-Iodo-2-(4-methylamino-phenyl)-chromen-4-one; 6-iodo-4'-methylaminoflavone |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12INO2 |
| Molecular Weight | 377.18 |
| CAS Registry Number | 871101-30-3 |
| SMILES | CNC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=CC(=C3)I |
| InChI | 1S/C16H12INO2/c1-18-12-5-2-10(3-6-12)16-9-14(19)13-8-11(17)4-7-15(13)20-16/h2-9,18H,1H3 |
| InChIKey | QIZWRTNISFPGTO-UHFFFAOYSA-N |
| Density | 1.7±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.2±45.0°C at 760 mmHg (Cal.) |
| Flash point | 250.8±28.7°C (Cal.) |
| Refractive index | 1.715 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Iodo-2-[4-(methylamino)phenyl]-4H-chromen-4-one |