|
CAS#: 871130-18-6 Product: 8,9-Diphenyldiphenanthro[4,3-d:3',4'-f][1,3,2]dioxaphosphepin-18-ol 18-oxide No suppilers available for the product. |
| Classification | Inorganic chemical industry >> Inorganic salt >> Phosphides, metal phosphoric acid, metaphosphoric acid, hypophosphorous acid and pyrophosphate |
|---|---|
| Name | 8,9-Diphenyldiphenanthro[4,3-d:3',4'-f][1,3,2]dioxaphosphepin-18-ol 18-oxide |
| Synonyms | (R)-(-)-VAPOL hydrogenphosphate; 18-Hydrox |
| Molecular Structure | ![]() |
| Molecular Formula | C40H25O4P |
| Molecular Weight | 600.60 |
| CAS Registry Number | 871130-18-6 |
| SMILES | C1=CC=C(C=C1)C2=C3C4=C(C=C5C=CC6=CC=CC=C6C5=C4OP(=O)(OC3=C7C(=C2)C=CC8=CC=CC=C87)O)C9=CC=CC=C9 |
| InChI | 1S/C40H25O4P/c41-45(42)43-39-35-29(21-19-27-15-7-9-17-31(27)35)23-33(25-11-3-1-4-12-25)37(39)38-34(26-13-5-2-6-14-26)24-30-22-20-28-16-8-10-18-32(28)36(30)40(38)44-45/h1-24H,(H,41,42) |
| InChIKey | YKIJNEDTUDPMNC-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Refractive index | 1.823 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 8,9-Diphenyldiphenanthro[4,3-d:3',4'-f][1,3,2]dioxaphosphepin-18-ol 18-oxide |