|
CAS#: 87138-72-5 Product: 3-Chlorotriamcinolone Acetonide No suppilers available for the product. |
| Name | 3-Chlorotriamcinolone Acetonide |
|---|---|
| Synonyms | 1-[(4as,5 |
| Molecular Structure | ![]() |
| Molecular Formula | C24H30ClFO5 |
| Molecular Weight | 452.94 |
| CAS Registry Number | 87138-72-5 |
| SMILES | Cl/C1=C/C2=C/C[C@H]3[C@H]4[C@](C[C@H](O)C3(F)[C@]2(/C=C1)C)([C@@]5(OC(O[C@H]5C4)(C)C)C(=O)CO)C |
| InChI | 1S/C24H30ClFO5/c1-20(2)30-19-10-16-15-6-5-13-9-14(25)7-8-21(13,3)23(15,26)17(28)11-22(16,4)24(19,31-20)18(29)12-27/h5,7-9,15-17,19,27-28H,6,10-12H2,1-4H3/t15-,16-,17-,19-,21-,22-,23?,24+/m0/s1 |
| InChIKey | YTIVSKLVOYYROL-TVHBQBCYSA-N |
| Density | 1.362g/cm3 (Cal.) |
|---|---|
| Boiling point | 580.463°C at 760 mmHg (Cal.) |
| Flash point | 304.853°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chlorotriamcinolone Acetonide |