|
CAS#: 87236-71-3 Product: (8-Hydroxy-7-quinolinyl)methyl dibutylcarbamodithioate No suppilers available for the product. |
| Name | (8-Hydroxy-7-quinolinyl)methyl dibutylcarbamodithioate |
|---|---|
| Synonyms | (8-hydroxyquinolin-7-yl)methyl dibutyldithiocarbamate |
| Molecular Structure | ![]() |
| Molecular Formula | C19H26N2OS2 |
| Molecular Weight | 362.55 |
| CAS Registry Number | 87236-71-3 |
| EINECS | 289-308-6 |
| SMILES | CCCCN(CCCC)C(=S)SCc1ccc2cccnc2c1O |
| InChI | 1S/C19H26N2OS2/c1-3-5-12-21(13-6-4-2)19(23)24-14-16-10-9-15-8-7-11-20-17(15)18(16)22/h7-11,22H,3-6,12-14H2,1-2H3 |
| InChIKey | GHUMBRRHICYOPL-UHFFFAOYSA-N |
| Density | 1.184g/cm3 (Cal.) |
|---|---|
| Boiling point | 515.087°C at 760 mmHg (Cal.) |
| Flash point | 265.315°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (8-Hydroxy-7-quinolinyl)methyl dibutylcarbamodithioate |