|
CAS#: 874571-88-7 Product: 3-Cyclohexyl-6-methyl-2-phenyl-3H-thieno[2,3-d]imidazole-5-carboxylic acid No suppilers available for the product. |
| Name | 3-Cyclohexyl-6-methyl-2-phenyl-3H-thieno[2,3-d]imidazole-5-carboxylic acid |
|---|---|
| Synonyms | 3H-THIENO |
| Molecular Structure | ![]() |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.44 |
| CAS Registry Number | 874571-88-7 |
| SMILES | O=C(O)c4sc1c(nc(n1C2CCCCC2)c3ccccc3)c4C |
| InChI | 1S/C19H20N2O2S/c1-12-15-18(24-16(12)19(22)23)21(14-10-6-3-7-11-14)17(20-15)13-8-4-2-5-9-13/h2,4-5,8-9,14H,3,6-7,10-11H2,1H3,(H,22,23) |
| InChIKey | GEJCZSCLDHSJOK-UHFFFAOYSA-N |
| Density | 1.372g/cm3 (Cal.) |
|---|---|
| Boiling point | 573.735°C at 760 mmHg (Cal.) |
| Flash point | 300.785°C (Cal.) |
| Refractive index | 1.704 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Cyclohexyl-6-methyl-2-phenyl-3H-thieno[2,3-d]imidazole-5-carboxylic acid |