|
CAS#: 87549-35-7 Product: 1-{4-[2-(Cyclopropylmethoxy)-1-hydroxyethyl]phenoxy}-3-(isopropylamino)-2-propanol No suppilers available for the product. |
| Name | 1-{4-[2-(Cyclopropylmethoxy)-1-hydroxyethyl]phenoxy}-3-(isopropylamino)-2-propanol |
|---|---|
| Synonyms | α-Hydroxybetaxolol |
| Molecular Structure | ![]() |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 |
| CAS Registry Number | 87549-35-7 |
| SMILES | OC(c1ccc(OCC(O)CNC(C)C)cc1)COCC2CC2 |
| InChI | 1S/C18H29NO4/c1-13(2)19-9-16(20)11-23-17-7-5-15(6-8-17)18(21)12-22-10-14-3-4-14/h5-8,13-14,16,18-21H,3-4,9-12H2,1-2H3 |
| InChIKey | NDOYCLDFWYZWIO-UHFFFAOYSA-N |
| Density | 1.13g/cm3 (Cal.) |
|---|---|
| Boiling point | 484.55°C at 760 mmHg (Cal.) |
| Flash point | 246.847°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-{4-[2-(Cyclopropylmethoxy)-1-hydroxyethyl]phenoxy}-3-(isopropylamino)-2-propanol |